Showing entry for 24-Methylenecycloartane-3beta,25-diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045428 |
| Compound Name | 24-Methylenecycloartane-3beta,25-diol |
| Structure | ![]() |
| Formula | C31H52O2 |
| InchiKey | WXYNTJQRYPFIJD-CHIINMNOSA-N |
| SMILES | C[C@@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C)CCC(=C)C(O)(C)C |
| Inchi | InChI=1S/C31H52O2/c1-20(9-10-21(2)27(5,6)33)22-13-15-29(8)24-12-11-23-26(3,4)25(32)14-16-30(23)19-31(24,30)18-17-28(22,29)7/h20,22-25,32-33H,2,9-19H2,1,3-8H3/t20-,22-,23+,24+,25+,28-,29+,30-,31+/m1/s1 |
| IUPAC | |
| Molecular Weight | 456.4 |
| Pubchem Id | 101226806 |
| Chembl Id | CHEMBL3359356 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3359356 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
