Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045462 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C43H48O14 |
| InchiKey | TUJWWEPVYORFJP-YWBUYCSRSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]2C(=C)[C@@H](OC/C=C/c3ccccc3)C[C@@H]([C@@]2(OC(=O)c2ccccc2)[C@@H](OC(=O)C)[C@@H]([C@@]2([C@]3([C@H]1CC(=O)[C@]2(OC3)C)C)O)OC(=O)C)OC(=O)C |
| Inchi | InChI=1S/C43H48O14/c1-24-32(51-20-14-17-29-15-10-8-11-16-29)22-34(53-25(2)44)42(57-39(49)30-18-12-9-13-19-30)35(24)36(54-26(3)45)31-21-33(48)41(7)43(50,40(31,6)23-52-41)38(56-28(5)47)37(42)55-27(4)46/h8-19,31-32,34-38,50H,1,20-23H2,2-7H3/b17-14+/t31-,32-, |
| IUPAC | |
| Molecular Weight | 788.3 |
| Pubchem Id | 118727425 |
| Chembl Id | CHEMBL3398371 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3398371 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
