Showing entry for Jejuchalcone E
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045478 |
| Compound Name | Jejuchalcone E |
| Structure | ![]() |
| Formula | C21H22O6 |
| InchiKey | IKKJERZRXAXEAP-UXBLZVDNSA-N |
| SMILES | COc1ccc(c2c1C(O)C(O2)C(O)(C)C)C(=O)/C=C/c1ccc(cc1)O |
| Inchi | InChI=1S/C21H22O6/c1-21(2,25)20-18(24)17-16(26-3)11-9-14(19(17)27-20)15(23)10-6-12-4-7-13(22)8-5-12/h4-11,18,20,22,24-25H,1-3H3/b10-6+ |
| IUPAC | |
| Molecular Weight | 370.14 |
| Pubchem Id | 102429836 |
| Chembl Id | CHEMBL3402552 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3402552 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
