Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045543 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C33H38O11 |
| InchiKey | QJYGVFKXJUMXAN-XJQORQGESA-N |
| SMILES | CC(=O)O[C@H]1C[C@](C)(O)[C@@]23[C@]([C@H]1O)(C)[C@@H](OC(=O)c1ccccc1)[C@H]([C@H]([C@H]3OC(=O)c1ccccc1)C(O2)(C)C)OC(=O)C |
| Inchi | InChI=1S/C33H38O11/c1-18(34)40-22-17-31(5,39)33-26(42-28(37)20-13-9-7-10-14-20)23(30(3,4)44-33)24(41-19(2)35)27(32(33,6)25(22)36)43-29(38)21-15-11-8-12-16-21/h7-16,22-27,36,39H,17H2,1-6H3/t22-,23+,24-,25-,26+,27-,31-,32-,33-/m0/s1 |
| IUPAC | |
| Molecular Weight | 610.24 |
| Pubchem Id | 122177556 |
| Chembl Id | CHEMBL3577216 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3577216 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
