Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045547 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C26H34O9 |
| InchiKey | RMLHAXMHDFQHQT-JCYWLEJHSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H]2C[C@]3([C@@]([C@@H]1OC(=O)c1ccccc1)(C)[C@@H](O)[C@H](C[C@]3(C)O)OC(=O)C)OC2(C)C |
| Inchi | InChI=1S/C26H34O9/c1-14(27)32-18-13-24(5,31)26-12-17(23(3,4)35-26)19(33-15(2)28)21(25(26,6)20(18)29)34-22(30)16-10-8-7-9-11-16/h7-11,17-21,29,31H,12-13H2,1-6H3/t17-,18-,19+,20-,21+,24-,25-,26-/m0/s1 |
| IUPAC | |
| Molecular Weight | 490.22 |
| Pubchem Id | 122177560 |
| Chembl Id | CHEMBL3577220 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3577220 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
