Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045572 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C33H46O5 |
| InchiKey | UMWJFTBXLSDEAV-CUEYUJEYSA-N |
| SMILES | CCC(C1=C(C=O)C[C@]2([C@H]1C(=O)[C@]1(CC=C(C)C)OC(=O)[C@@](C1=O)(C[C@@H]2CC=C(C)C)CC=C(C)C)C)C |
| Inchi | InChI=1S/C33H46O5/c1-10-23(8)26-24(19-34)17-31(9)25(12-11-20(2)3)18-32(15-13-21(4)5)29(36)33(38-30(32)37,16-14-22(6)7)28(35)27(26)31/h11,13-14,19,23,25,27H,10,12,15-18H2,1-9H3/t23?,25-,27+,31+,32+,33-/m0/s1 |
| IUPAC | |
| Molecular Weight | 522.33 |
| Pubchem Id | 122178951 |
| Chembl Id | CHEMBL3581570 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581570 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
