Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045577 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C33H42O5 |
| InchiKey | XSDRHNKEHDLYOV-WBUGVDGJSA-N |
| SMILES | CC(=CC[C@]12C[C@@H]3[C@H]4C(C1=O)(C[C@@H](C([C@@H]4O)(C)C)C(C)C)C(=O)[C@](C2=O)(C3(C)C)C(=O)c1ccccc1)C |
| Inchi | InChI=1S/C33H42O5/c1-18(2)14-15-31-16-22-23-25(35)29(5,6)21(19(3)4)17-32(23,26(31)36)28(38)33(27(31)37,30(22,7)8)24(34)20-12-10-9-11-13-20/h9-14,19,21-23,25,35H,15-17H2,1-8H3/t21-,22-,23-,25-,31+,32?,33+/m1/s1 |
| IUPAC | |
| Molecular Weight | 518.3 |
| Pubchem Id | 122178955 |
| Chembl Id | CHEMBL3581576 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581576 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
