Showing entry for Gypenoside GD3
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045610 |
| Compound Name | Gypenoside GD3 |
| Structure | ![]() |
| Formula | C42H72O16 |
| InchiKey | OUZGLMQJFNSAPO-GXCPRVIISA-N |
| SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@]([C@H]3CC[C@@]4([C@@H]3[C@H](O)C[C@H]3[C@@]4(C)CC[C@@H]4[C@]3(C)C[C@@H](O)[C@@H](C4(C)C)O)C)(C/C=C/C(OO)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C42H72O16/c1-37(2,58-53)12-9-13-42(8,57-36-33(51)31(49)29(47)24(56-36)19-54-35-32(50)30(48)28(46)23(18-43)55-35)20-10-14-41(7)27(20)21(44)16-26-39(5)17-22(45)34(52)38(3,4)25(39)11-15-40(26,41)6/h9,12,20-36,43-53H,10-11,13-19H2,1-8H3/b12-9+/t20-,2 |
| IUPAC | |
| Molecular Weight | 832.48 |
| Pubchem Id | 122179020 |
| Chembl Id | CHEMBL3581708 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581708 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
