Showing entry for 2,4-Dihydroxyphenyl 2-(3,7-dimethyl-7-methoxy-2-octenyl)-3,4-dihydroxyphenethyl ketone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045650 |
| Compound Name | 2,4-Dihydroxyphenyl 2-(3,7-dimethyl-7-methoxy-2-octenyl)-3,4-dihydroxyphenethyl ketone |
| Structure | ![]() |
| Formula | C26H34O6 |
| InchiKey | JHLPMSFZJFPKFH-REZTVBANSA-N |
| SMILES | COC(CCC/C(=C/Cc1c(CCC(=O)c2ccc(cc2O)O)ccc(c1O)O)/C)(C)C |
| Inchi | InChI=1S/C26H34O6/c1-17(6-5-15-26(2,3)32-4)7-11-20-18(9-14-23(29)25(20)31)8-13-22(28)21-12-10-19(27)16-24(21)30/h7,9-10,12,14,16,27,29-31H,5-6,8,11,13,15H2,1-4H3/b17-7+ |
| IUPAC | |
| Molecular Weight | 442.24 |
| Pubchem Id | 102193943 |
| Chembl Id | CHEMBL3593937 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3593937 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
