Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045738 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C29H42O6 |
| InchiKey | HDHAFLPMEFZPKI-SYNCWSQBSA-N |
| SMILES | C[C@@H](CC[C@H]1[C@H]2[C@@H]1C[C@@H]1[C@H](C2)[C@]2(C[C@@H]([C@@]3([C@H]2C[C@H]2[C@@H](C3)OC(=O)C2=C)C)CCC(O)C)C(=O)O1)O |
| Inchi | InChI=1S/C29H42O6/c1-14(30)5-7-17-12-29(25-11-19-16(3)26(32)34-24(19)13-28(17,25)4)22-9-20-18(8-6-15(2)31)21(20)10-23(22)35-27(29)33/h14-15,17-25,30-31H,3,5-13H2,1-2,4H3/t14?,15-,17-,18-,19+,20-,21+,22-,23+,24+,25+,28+,29-/m0/s1 |
| IUPAC | |
| Molecular Weight | 486.3 |
| Pubchem Id | 122192394 |
| Chembl Id | CHEMBL3623292 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3623292 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
