Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045741 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C36H60O8 |
| InchiKey | YMMNRYLXTXERPB-QZIIJZFNSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3/C(=C/C[C@@H](C(=C)C)O)/C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C36H60O8/c1-19(2)22(38)10-9-20(3)21-11-15-36(8)28(21)23(39)17-26-34(6)14-13-27(33(4,5)25(34)12-16-35(26,36)7)44-32-31(42)30(41)29(40)24(18-37)43-32/h9,21-32,37-42H,1,10-18H2,2-8H3/b20-9+/t21-,22+,23-,24-,25+,26-,27+,28+,29-,30+,31-,32+,34+,35-,36 |
| IUPAC | |
| Molecular Weight | 620.43 |
| Pubchem Id | 122196264 |
| Chembl Id | CHEMBL3634635 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3634635 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
