Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045742 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C38H64O10 |
| InchiKey | SMHMKYWUENKQRV-VXJKQVLXSA-N |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2C[C@]3(C)[C@@H]([C@@]4([C@@H]2C(C)(C)[C@@H](O)CC4)C)C[C@H]([C@H]2[C@@]3(C)CC[C@@H]2[C@](CCC=C(C)C)(O)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C38H64O10/c1-20(2)11-10-14-38(9,45)22-12-16-36(7)28(22)23(40)17-26-35(6)15-13-27(41)34(4,5)32(35)24(18-37(26,36)8)47-33-31(44)30(43)29(42)25(48-33)19-46-21(3)39/h11,22-33,40-45H,10,12-19H2,1-9H3/t22-,23+,24-,25+,26+,27-,28-,29+,30-,31+,32-,33+,35 |
| IUPAC | |
| Molecular Weight | 680.45 |
| Pubchem Id | 122196265 |
| Chembl Id | CHEMBL3634636 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3634636 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
