Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045743 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C36H60O8 |
| InchiKey | STGSRVGAMRCRDT-QWPWDPHFSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)[C@@H](O)C[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3/C(=C/CC=C(C)C)/C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C36H60O8/c1-19(2)10-9-11-20(3)21-12-15-35(7)27(21)22(38)16-25-34(6)14-13-26(33(4,5)31(34)23(39)17-36(25,35)8)44-32-30(42)29(41)28(40)24(18-37)43-32/h10-11,21-32,37-42H,9,12-18H2,1-8H3/b20-11+/t21-,22-,23+,24-,25-,26+,27+,28-,29+,30-,31+,32+,34-,3 |
| IUPAC | |
| Molecular Weight | 620.43 |
| Pubchem Id | 122196266 |
| Chembl Id | CHEMBL3634638 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3634638 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
