Showing entry for Capsicodendrin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045752 |
| Compound Name | Capsicodendrin |
| Structure | ![]() |
| Formula | C34H48O10 |
| InchiKey | ASRYDWWUAZEWIH-QXSHUVCSSA-N |
| SMILES | O=C[C@@]1(O)C(=C[C@H]([C@@H]2[C@]1(C)CCCC2(C)C)OC(=O)C)C1O[C@H]2[C@@]3(O1)C(=C[C@H]([C@@H]1[C@]3(C)CCCC1(C)C)OC(=O)C)C(O2)O |
| Inchi | InChI=1S/C34H48O10/c1-18(36)40-22-15-20-26(38)42-28-34(20,32(8)14-10-12-30(5,6)25(22)32)44-27(43-28)21-16-23(41-19(2)37)24-29(3,4)11-9-13-31(24,7)33(21,39)17-35/h15-17,22-28,38-39H,9-14H2,1-8H3/t22-,23-,24+,25+,26?,27?,28+,31+,32+,33-,34+/m1/s1 |
| IUPAC | |
| Molecular Weight | 616.32 |
| Pubchem Id | 44419494 |
| Chembl Id | CHEMBL376261 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL376261 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
