Showing entry for 3Beta,6Beta-Dihydroxyolean-12-En-27-Oic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045754 |
| Compound Name | 3Beta,6Beta-Dihydroxyolean-12-En-27-Oic Acid |
| Structure | ![]() |
| Formula | C30H48O4 |
| InchiKey | LUJTWDWEYNWTBP-ULYQHCOQSA-N |
| SMILES | O[C@@H]1C[C@]2(C)[C@@H]([C@@]3(C1C(C)(C)[C@@H](O)CC3)C)CC=C1[C@]2(CC[C@@]2([C@H]1CC(CC2)(C)C)C)C(=O)O |
| Inchi | InChI=1S/C30H48O4/c1-25(2)12-13-27(5)14-15-30(24(33)34)18(19(27)16-25)8-9-21-28(6)11-10-22(32)26(3,4)23(28)20(31)17-29(21,30)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20+,21+,22-,23?,27+,28+,29+,30+/m0/s1 |
| IUPAC | (4aR,6aR,6aR,6bR,8R,10S,12aR,14bR)-8,10-dihydroxy-2,2,4a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-6a-carboxylic acid |
| Molecular Weight | 472.36 |
| Pubchem Id | 44411962 |
| Chembl Id | CHEMBL377760 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50185125 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL377760 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
