Showing entry for cinnafragrin B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045759 |
| Compound Name | cinnafragrin B |
| Structure | ![]() |
| Formula | C35H50O10 |
| InchiKey | YTRTYDPOBBBIPO-UHNSDNJXSA-N |
| SMILES | COC1O[C@@H]2[C@]3(C1=C[C@@H](OC(=O)C)[C@@H]1[C@]3(C)CCCC1(C)C)O[C@H](O2)C1=C[C@@H](OC(=O)C)[C@@H]2[C@]([C@@]1(O)C=O)(C)CCCC2(C)C |
| Inchi | InChI=1S/C35H50O10/c1-19(37)41-23-16-21(34(39,18-36)32(7)14-10-12-30(3,4)25(23)32)28-44-29-35(45-28)22(27(40-9)43-29)17-24(42-20(2)38)26-31(5,6)13-11-15-33(26,35)8/h16-18,23-29,39H,10-15H2,1-9H3/t23-,24-,25+,26+,27?,28+,29+,32+,33+,34-,35+/m1/s1 |
| IUPAC | |
| Molecular Weight | 630.34 |
| Pubchem Id | 44419504 |
| Chembl Id | CHEMBL385716 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL385716 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
