Showing entry for Cistanoside F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045772 |
| Compound Name | Cistanoside F |
| Structure | ![]() |
| Formula | C21H28O13 |
| InchiKey | IDVRYIVYDAOHSS-CRADLMAESA-N |
| SMILES | OC[C@H]1O[C@@H](O)[C@@H]([C@H]([C@@H]1OC(=O)/C=C/c1ccc(c(c1)O)O)O[C@H]1O[C@H](C)[C@H]([C@@H]([C@@H]1O)O)O)O |
| Inchi | InChI=1S/C21H28O13/c1-8-14(26)15(27)16(28)21(31-8)34-19-17(29)20(30)32-12(7-22)18(19)33-13(25)5-3-9-2-4-10(23)11(24)6-9/h2-6,8,12,14-24,26-30H,7H2,1H3/b5-3+/t8-,12-,14-,15+,16+,17-,18-,19-,20-,21-/m1/s1 |
| IUPAC | |
| Molecular Weight | 488.15 |
| Pubchem Id | 44429870 |
| Chembl Id | CHEMBL393549 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL393549 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
