Showing entry for isosarcodine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045821 |
| Compound Name | isosarcodine |
| Structure | ![]() |
| Formula | C26H46N2O |
| InchiKey | WDKKOVABYKVZIW-VCJWWASDSA-N |
| SMILES | CN([C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C)CC[C@@H](C2)N(C(=O)C)C)C)C |
| Inchi | InChI=1S/C26H46N2O/c1-17(27(5)6)22-10-11-23-21-9-8-19-16-20(28(7)18(2)29)12-14-25(19,3)24(21)13-15-26(22,23)4/h17,19-24H,8-16H2,1-7H3/t17-,19-,20-,21-,22+,23-,24-,25-,26+/m0/s1 |
| IUPAC | |
| Molecular Weight | 402.36 |
| Pubchem Id | 44358214 |
| Chembl Id | CHEMBL434042 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50421622 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL434042 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
