Showing entry for thalifaberidine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045856 |
| Compound Name | thalifaberidine |
| Structure | ![]() |
| Formula | C39H44N2O8 |
| InchiKey | ASHXFBBPKYCWEY-VMPREFPWSA-N |
| SMILES | COc1cc2c(c(c1O)Oc1ccc(cc1)C[C@@H]1N(C)CCc3c1cc(OC)c(c3)O)C[C@H]1c3c2c(OC)c(c(c3CCN1C)OC)OC |
| Inchi | InChI=1S/C39H44N2O8/c1-40-14-12-22-17-30(42)31(44-3)19-25(22)28(40)16-21-8-10-23(11-9-21)49-36-27-18-29-33-24(13-15-41(29)2)37(46-5)39(48-7)38(47-6)34(33)26(27)20-32(45-4)35(36)43/h8-11,17,19-20,28-29,42-43H,12-16,18H2,1-7H3/t28-,29-/m0/s1 |
| IUPAC | |
| Molecular Weight | 668.31 |
| Pubchem Id | 157828 |
| Chembl Id | CHEMBL446572 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL446572 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
