Showing entry for 2,5-Dideoxy-2,5-Imino-D-Glycero-D-Manno-Heptitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045942 |
| Compound Name | 2,5-Dideoxy-2,5-Imino-D-Glycero-D-Manno-Heptitol |
| Structure | ![]() |
| Formula | C7H15NO5 |
| InchiKey | ZJRUOSSQTZGFJV-UHEPRFFZSA-N |
| SMILES | OCC([C@H]1N[C@@H]([C@H]([C@@H]1O)O)CO)O |
| Inchi | InChI=1S/C7H15NO5/c9-1-3-6(12)7(13)5(8-3)4(11)2-10/h3-13H,1-2H2/t3-,4?,5-,6-,7-/m1/s1 |
| IUPAC | (2R,3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| Molecular Weight | 193.1 |
| Pubchem Id | 13005892 |
| Chembl Id | CHEMBL456077 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50242071 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL456077 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
