Showing entry for sigmoidin G
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045945 |
| Compound Name | sigmoidin G |
| Structure | ![]() |
| Formula | C20H22O8 |
| InchiKey | OYKVSVOHAHXIEQ-UHFFFAOYSA-N |
| SMILES | OC1OC2=C(O)C(=C(C(C2C(C1O)O)(C)C)C1CC(=O)c2c(O1)cccc2)O |
| Inchi | InChI=1S/C20H22O8/c1-20(2)12(11-7-9(21)8-5-3-4-6-10(8)27-11)14(22)16(24)18-13(20)15(23)17(25)19(26)28-18/h3-6,11,13,15,17,19,22-26H,7H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 390.13 |
| Pubchem Id | 44589234 |
| Chembl Id | CHEMBL456655 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL456655 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
