Showing entry for Marchantin A Trimethyl Ether
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045999 |
| Compound Name | Marchantin A Trimethyl Ether |
| Structure | ![]() |
| Formula | C31H30O5 |
| InchiKey | JNMUZWBJUZBJLP-UHFFFAOYSA-N |
| SMILES | COc1cc2CCc3cccc(c3)Oc3c(CCc4ccc(Oc(c1OC)c2)cc4)cccc3OC |
| Inchi | InChI=1S/C31H30O5/c1-32-27-9-5-7-24-15-12-21-13-16-25(17-14-21)35-29-20-23(19-28(33-2)31(29)34-3)11-10-22-6-4-8-26(18-22)36-30(24)27/h4-9,13-14,16-20H,10-12,15H2,1-3H3 |
| IUPAC | |
| Molecular Weight | 482.21 |
| Pubchem Id | 10457959 |
| Chembl Id | CHEMBL463761 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463761 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
