Showing entry for (+)-5-Methoxyhamaudol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046014 |
| Compound Name | (+)-5-Methoxyhamaudol |
| Structure | ![]() |
| Formula | C16H18O5 |
| InchiKey | SGCZPPRRLCNDAZ-CYBMUJFWSA-N |
| SMILES | COc1c2C[C@@H](O)C(Oc2cc2c1c(=O)cc(o2)C)(C)C |
| Inchi | InChI=1S/C16H18O5/c1-8-5-10(17)14-12(20-8)7-11-9(15(14)19-4)6-13(18)16(2,3)21-11/h5,7,13,18H,6H2,1-4H3/t13-/m1/s1 |
| IUPAC | |
| Molecular Weight | 290.12 |
| Pubchem Id | 11033588 |
| Chembl Id | CHEMBL464886 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL464886 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
