Showing entry for 4-Terpenyl Cannabinolate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046024 |
| Compound Name | 4-Terpenyl Cannabinolate |
| Structure | ![]() |
| Formula | C32H42O4 |
| InchiKey | CTWVUTHJMAYHKZ-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc2OC(C)(C)c3c(c2c(c1C(=O)OC1(CCC(=CC1)C)C(C)C)O)cc(cc3)C |
| Inchi | InChI=1S/C32H42O4/c1-8-9-10-11-23-19-26-28(24-18-22(5)12-13-25(24)31(6,7)35-26)29(33)27(23)30(34)36-32(20(2)3)16-14-21(4)15-17-32/h12-14,18-20,33H,8-11,15-17H2,1-7H3 |
| IUPAC | |
| Molecular Weight | 490.31 |
| Pubchem Id | 24850050 |
| Chembl Id | CHEMBL465713 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465713 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
