Showing entry for 29-Acetoxy-3-oxotirucalla-7,24-diene-21-oic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046068 |
| Compound Name | 29-Acetoxy-3-oxotirucalla-7,24-diene-21-oic acid |
| Structure | ![]() |
| Formula | C32H48O5 |
| InchiKey | WNBQUUXWPDCLBL-SURDOKLXSA-N |
| SMILES | CC(=O)OC[C@@]1(C)C(=O)CC[C@]2([C@H]1CC=C1[C@@H]2CC[C@@]2([C@]1(C)CC[C@H]2[C@@H](C(=O)O)CCC=C(C)C)C)C |
| Inchi | InChI=1S/C32H48O5/c1-20(2)9-8-10-22(28(35)36)23-13-17-32(7)25-11-12-26-29(4,24(25)14-18-31(23,32)6)16-15-27(34)30(26,5)19-37-21(3)33/h9,11,22-24,26H,8,10,12-19H2,1-7H3,(H,35,36)/t22-,23-,24-,26+,29+,30+,31-,32+/m0/s1 |
| IUPAC | |
| Molecular Weight | 512.35 |
| Pubchem Id | 10529766 |
| Chembl Id | CHEMBL474062 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL474062 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
