Showing entry for 3beta-Hydroxytirucalla-7,24-diene-21-oic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046084 |
| Compound Name | 3beta-Hydroxytirucalla-7,24-diene-21-oic acid |
| Structure | ![]() |
| Formula | C30H48O3 |
| InchiKey | CGPBVNAIDFBRJG-ZRMZZLDZSA-N |
| SMILES | CC(=CCC[C@@H]([C@@H]1CC[C@]2([C@@]1(C)CC[C@H]1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C(=O)O)C |
| Inchi | InChI=1S/C30H48O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,11,20-22,24-25,31H,8,10,12-18H2,1-7H3,(H,32,33)/t20-,21-,22-,24-,25-,28+,29-,30+/m0/s1 |
| IUPAC | |
| Molecular Weight | 456.36 |
| Pubchem Id | 10695137 |
| Chembl Id | CHEMBL479306 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL479306 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
