Showing entry for Phaitanthrins A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046301 |
| Compound Name | Phaitanthrins A |
| Structure | ![]() |
| Formula | C18H14N2O3 |
| InchiKey | CCFVLTFAPUCNHB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1(O)c2nc3ccccc3c(=O)n2c2c1cccc2 |
| Inchi | InChI=1S/C18H14N2O3/c1-11(21)10-18(23)13-7-3-5-9-15(13)20-16(22)12-6-2-4-8-14(12)19-17(18)20/h2-9,23H,10H2,1H3 |
| IUPAC | 6-hydroxy-6-(2-oxopropyl)indolo[2,1-b]quinazolin-12-one |
| Molecular Weight | 306.1 |
| Pubchem Id | 24970702 |
| Chembl Id | CHEMBL508897 |
| Targets of Information Source | ||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||
| CHEMBL | CHEMBL508897 |
|
||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
