Showing entry for Megathyrin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046352 |
| Compound Name | Megathyrin A |
| Structure | ![]() |
| Formula | C20H28O5 |
| InchiKey | VPZCKRKZFRCZMX-KLQXUPCOSA-N |
| SMILES | C=C1[C@@H]2CC[C@@H]3[C@](C1=O)([C@@H]2O)[C@@]1(O)OC[C@@]23[C@@H](O)CCC([C@H]2C1)(C)C |
| Inchi | InChI=1S/C20H28O5/c1-10-11-4-5-12-18-9-25-19(24,20(12,15(10)22)16(11)23)8-13(18)17(2,3)7-6-14(18)21/h11-14,16,21,23-24H,1,4-9H2,2-3H3/t11-,12-,13+,14-,16+,18-,19-,20-/m0/s1 |
| IUPAC | |
| Molecular Weight | 348.19 |
| Pubchem Id | 10315734 |
| Chembl Id | CHEMBL516482 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL516482 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
