Showing entry for AMAZOQUINONE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046365 |
| Compound Name | AMAZOQUINONE |
| Structure | ![]() |
| Formula | C28H36O4 |
| InchiKey | VLFARXJZJZUOGT-OPNCVHMMSA-N |
| SMILES | C[C@@H]1C[C@@H]2[C@@](CC1=O)(C)CC[C@]1([C@@]2(C)CC[C@@]2([C@H]1C(=O)C=C1C2=CC(=O)C(=C1C)O)C)C |
| Inchi | InChI=1S/C28H36O4/c1-15-11-22-25(3,14-21(15)31)7-9-28(6)24-20(30)12-17-16(2)23(32)19(29)13-18(17)26(24,4)8-10-27(22,28)5/h12-13,15,22,24,32H,7-11,14H2,1-6H3/t15-,22-,24-,25+,26+,27+,28-/m1/s1 |
| IUPAC | |
| Molecular Weight | 436.26 |
| Pubchem Id | 44559090 |
| Chembl Id | CHEMBL517612 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL517612 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
