Showing entry for 3beta,29-Dihydroxytirucalla-7,24-diene-21-oic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046373 |
| Compound Name | 3beta,29-Dihydroxytirucalla-7,24-diene-21-oic acid |
| Structure | ![]() |
| Formula | C30H48O4 |
| InchiKey | NWCRCEJGWLWBDH-NVWYCCQMSA-N |
| SMILES | OC[C@@]1(C)[C@@H](O)CC[C@]2([C@H]1CC=C1[C@@H]2CC[C@@]2([C@]1(C)CC[C@H]2[C@@H](C(=O)O)CCC=C(C)C)C)C |
| Inchi | InChI=1S/C30H48O4/c1-19(2)8-7-9-20(26(33)34)21-12-16-30(6)23-10-11-24-27(3,22(23)13-17-29(21,30)5)15-14-25(32)28(24,4)18-31/h8,10,20-22,24-25,31-32H,7,9,11-18H2,1-6H3,(H,33,34)/t20-,21-,22-,24+,25-,27+,28+,29-,30+/m0/s1 |
| IUPAC | |
| Molecular Weight | 472.36 |
| Pubchem Id | 10814325 |
| Chembl Id | CHEMBL518610 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL518610 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
