Showing entry for Rhodionin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046503 |
| Compound Name | Rhodionin |
| Structure | ![]() |
| Formula | C21H20O11 |
| InchiKey | CIAXXTSXVCLEJK-GPRRHACJSA-N |
| SMILES | O[C@H]1C(O[C@H]([C@@H]([C@H]1O)O)C)Oc1cc(O)c2c(c1O)oc(c(c2=O)O)c1ccc(cc1)O |
| Inchi | InChI=1S/C21H20O11/c1-7-13(24)16(27)18(29)21(30-7)31-11-6-10(23)12-15(26)17(28)19(32-20(12)14(11)25)8-2-4-9(22)5-3-8/h2-7,13,16,18,21-25,27-29H,1H3/t7-,13-,16+,18+,21?/m0/s1 |
| IUPAC | 3,5,8-trihydroxy-2-(4-hydroxyphenyl)-7-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| Molecular Weight | 448.1 |
| Pubchem Id | 46226584 |
| Chembl Id | CHEMBL596258 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50304347 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL596258 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
