Showing entry for crebanine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046508 |
| Compound Name | crebanine |
| Structure | ![]() |
| Formula | C20H21NO4 |
| InchiKey | UVDQDNQWGQFIAO-UHFFFAOYSA-N |
| SMILES | COc1c(OC)ccc2c1CC1N(C)CCc3c1c2c1OCOc1c3 |
| Inchi | InChI=1S/C20H21NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8,14H,6-7,9-10H2,1-3H3 |
| IUPAC | |
| Molecular Weight | 339.15 |
| Pubchem Id | 159999 |
| Chembl Id | CHEMBL604339 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL604339 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
