Showing entry for Sabandinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046513 |
| Compound Name | Sabandinol |
| Structure | ![]() |
| Formula | C15H16O7 |
| InchiKey | RDPGEFVUMRTSBB-UHFFFAOYSA-N |
| SMILES | O=c1ccc2c(o1)cc1c(c2OCC(C(O)(C)C)O)OCO1 |
| Inchi | InChI=1S/C15H16O7/c1-15(2,18)11(16)6-19-13-8-3-4-12(17)22-9(8)5-10-14(13)21-7-20-10/h3-5,11,16,18H,6-7H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 308.09 |
| Pubchem Id | 179597 |
| Chembl Id | CHEMBL611815 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL611815 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
