Showing entry for Methyl 2-amino-4-chlorobenzoate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046531 |
| Compound Name | Methyl 2-amino-4-chlorobenzoate |
| Structure | ![]() |
| Formula | C8H8ClNO2 |
| InchiKey | YPSSCICDVDOEAI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1N)Cl |
| Inchi | InChI=1S/C8H8ClNO2/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4H,10H2,1H3 |
| IUPAC | methyl 2-amino-4-chlorobenzoate |
| Molecular Weight | 185.02 |
| Pubchem Id | 80001 |
| Chembl Id | CHEMBL1234477 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | MS9 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1234477 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
