Showing entry for Thevetiaflavone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046543 |
| Compound Name | Thevetiaflavone |
| Structure | ![]() |
| Formula | C16H12O5 |
| InchiKey | YQABHAHJGSNVQR-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc2c1c(=O)cc(o2)c1ccc(cc1)O |
| Inchi | InChI=1S/C16H12O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| IUPAC | 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxychromen-4-one |
| Molecular Weight | 284.07 |
| Pubchem Id | 5315202 |
| Chembl Id | CHEMBL182265 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL182265 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
