Showing entry for Arteminorin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046635 |
| Compound Name | Arteminorin C |
| Structure | ![]() |
| Formula | C20H14O9 |
| InchiKey | XFGGVXYNIBUVBK-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(c(=O)oc2c(c1O)OC)c1cc2cc(O)c(cc2oc1=O)O |
| Inchi | InChI=1S/C20H14O9/c1-26-15-6-9-4-11(20(25)29-17(9)18(27-2)16(15)23)10-3-8-5-12(21)13(22)7-14(8)28-19(10)24/h3-7,21-23H,1-2H3 |
| IUPAC | 3-(6,7-dihydroxy-2-oxochromen-3-yl)-7-hydroxy-6,8-dimethoxychromen-2-one |
| Molecular Weight | 398.06 |
| Pubchem Id | 44178672 |
| Chembl Id | CHEMBL1085430 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50310442 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1085430 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
