Showing entry for Hyphenrone D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046722 |
| Compound Name | Hyphenrone D |
| Structure | ![]() |
| Formula | C38H48O5 |
| InchiKey | FPHBKYRPWQOBBF-PPXCZVBLSA-N |
| SMILES | CC(=CC[C@H]1C[C@@]2(CC=C(C)C)C(=O)O[C@](C2=O)(C(=O)[C@]23[C@]1(C)CC[C@@H]3C(c1c(C2=O)cccc1)(C)C)CC=C(C)C)C |
| Inchi | InChI=1S/C38H48O5/c1-23(2)14-15-26-22-36(20-16-24(3)4)31(40)37(43-33(36)42,21-17-25(5)6)32(41)38-29(18-19-35(26,38)9)34(7,8)28-13-11-10-12-27(28)30(38)39/h10-14,16-17,26,29H,15,18-22H2,1-9H3/t26-,29+,35+,36+,37+,38+/m0/s1 |
| IUPAC | |
| Molecular Weight | 584.35 |
| Pubchem Id | 102129929 |
| Chembl Id | CHEMBL3581571 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581571 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
