Showing entry for DIHYDROMORIN
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046744 |
| Compound Name | DIHYDROMORIN |
| Structure | ![]() |
| Formula | C15H12O7 |
| InchiKey | QIWOFDHUQPJCJF-LSDHHAIUSA-N |
| SMILES | Oc1ccc(c(c1)O)[C@H]1Oc2cc(O)cc(c2C(=O)[C@@H]1O)O |
| Inchi | InChI=1S/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15+/m0/s1 |
| IUPAC | (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| Molecular Weight | 304.06 |
| Pubchem Id | 5458714 |
| Chembl Id | CHEMBL463453 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463453 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
