Showing entry for dehydrocorydalmine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046977 |
| Compound Name | dehydrocorydalmine |
| Structure | ![]() |
| Formula | C20H19NO4 |
| InchiKey | VQSYXVWEZATIHL-UHFFFAOYSA-O |
| SMILES | COc1cc2c(cc1OC)CCn1c2cc2ccc(=[O+])c(c2c1)OC |
| Inchi | InChI=1S/C20H19NO4/c1-23-18-9-13-6-7-21-11-15-12(4-5-17(22)20(15)25-3)8-16(21)14(13)10-19(18)24-2/h4-5,8-11H,6-7H2,1-3H3/p+1 |
| IUPAC | 2,3,9-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-10-ol |
| Molecular Weight | 338.14 |
| Pubchem Id | 3083983 |
| Chembl Id | CHEMBL1618061 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50328691 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1618061 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
