Showing entry for beta-D-Arabinopyranose
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0046993 |
| Compound Name | beta-D-Arabinopyranose |
| Structure | ![]() |
| Formula | C5H10O5 |
| InchiKey | SRBFZHDQGSBBOR-SQOUGZDYSA-N |
| SMILES | O[C@@H]1CO[C@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m1/s1 |
| IUPAC | (2R,3S,4R,5R)-oxane-2,3,4,5-tetrol |
| Molecular Weight | 150.05 |
| Pubchem Id | 444173 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | SEJ |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
