Showing entry for Xanthiazone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0047615 |
| Compound Name | Xanthiazone |
| Structure | ![]() |
| Formula | C11H13NO3S |
| InchiKey | DNLBWKAXMIGTSS-UHFFFAOYSA-N |
| SMILES | OCC1=CC(=O)C2=C(C1(C)C)SCC(=N2)O |
| Inchi | InChI=1S/C11H13NO3S/c1-11(2)6(4-13)3-7(14)9-10(11)16-5-8(15)12-9/h3,13H,4-5H2,1-2H3,(H,12,15) |
| IUPAC | 7-(hydroxymethyl)-8,8-dimethyl-4H-1,4-benzothiazine-3,5-dione |
| Molecular Weight | 239.06 |
| Pubchem Id | 15945057 |
| Chembl Id | CHEMBL1350218 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1350218 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
