Showing entry for Gentiakochianin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048479 |
| Compound Name | Gentiakochianin |
| Structure | ![]() |
| Formula | C14H10O6 |
| InchiKey | BDBVOZGRVBXANN-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)oc1c(c2=O)c(O)c(cc1)O |
| Inchi | InChI=1S/C14H10O6/c1-19-6-4-8(16)11-10(5-6)20-9-3-2-7(15)13(17)12(9)14(11)18/h2-5,15-17H,1H3 |
| IUPAC | 1,2,8-trihydroxy-6-methoxyxanthen-9-one |
| Molecular Weight | 274.05 |
| Pubchem Id | 5281661 |
| Chembl Id | CHEMBL187044 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50155435 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL187044 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
