Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048564 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C36H56O12 |
| InchiKey | AFXPJFXBBQEMAB-VPBSPBINSA-N |
| SMILES | OC/C(=C/[C@H]1O[C@@H]2C[C@@]3([C@]([C@H]2[C@@](C1)(C)O)(C)CC(=O)[C@@]1([C@H]3[C@@H](O)C=C2[C@H]1C[C@@H]([C@@H](C2(C)C)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)C)C)/C |
| Inchi | InChI=1S/C36H56O12/c1-16(14-37)8-17-11-35(6,45)29-22(46-17)12-33(4)28-20(39)9-18-19(36(28,7)24(40)13-34(29,33)5)10-21(30(44)32(18,2)3)47-31-27(43)26(42)25(41)23(15-38)48-31/h8-9,17,19-23,25-31,37-39,41-45H,10-15H2,1-7H3/b16-8+/t17-,19-,20+,21+,22-,23-,25- |
| IUPAC | |
| Molecular Weight | 680.38 |
| Pubchem Id | 44139605 |
| Chembl Id | CHEMBL552760 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL552760 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
