Showing entry for Beta-Carboline-1-propanoic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048571 |
| Compound Name | Beta-Carboline-1-propanoic acid |
| Structure | ![]() |
| Formula | C14H12N2O2 |
| InchiKey | CNUHEVWYPKFJHH-UHFFFAOYSA-N |
| SMILES | OC(=O)CCc1nccc2c1[nH]c1c2cccc1 |
| Inchi | InChI=1S/C14H12N2O2/c17-13(18)6-5-12-14-10(7-8-15-12)9-3-1-2-4-11(9)16-14/h1-4,7-8,16H,5-6H2,(H,17,18) |
| IUPAC | 3-(9H-pyrido[3,4-b]indol-1-yl)propanoic acid |
| Molecular Weight | 240.09 |
| Pubchem Id | 5375436 |
| Chembl Id | CHEMBL512759 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL512759 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
