Showing entry for Caulolactone B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048670 |
| Compound Name | Caulolactone B |
| Structure | ![]() |
| Formula | C15H22O2 |
| InchiKey | ZZEKLJSJUUZCFB-CORIIIEPSA-N |
| SMILES | CC(=C)[C@@H]1CC[C@@]2([C@H]1CC(=C(C)C)C(=O)O2)C |
| Inchi | InChI=1S/C15H22O2/c1-9(2)11-6-7-15(5)13(11)8-12(10(3)4)14(16)17-15/h11,13H,1,6-8H2,2-5H3/t11-,13-,15+/m0/s1 |
| IUPAC | (4aS,5R,7aR)-7a-methyl-3-propan-2-ylidene-5-prop-1-en-2-yl-4a,5,6,7-tetrahydro-4H-cyclopenta[b]pyran-2-one |
| Molecular Weight | 234.16 |
| Pubchem Id | 71720006 |
| Chembl Id | CHEMBL2332426 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2332426 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
