Showing entry for tiglic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048746 |
| Compound Name | tiglic acid |
| Structure | ![]() |
| Formula | C5H8O2 |
| InchiKey | UIERETOOQGIECD-ONEGZZNKSA-N |
| SMILES | C/C(=C\C)/C(=O)O |
| Inchi | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3+ |
| IUPAC | (E)-2-methylbut-2-enoic acid |
| Molecular Weight | 100.05 |
| Pubchem Id | 125468 |
| Chembl Id | CHEMBL52416 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL52416 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
