Showing entry for heliotrine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048769 |
| Compound Name | heliotrine |
| Structure | ![]() |
| Formula | C16H27NO5 |
| InchiKey | LMFKRLGHEKVMNT-UJDVCPFMSA-N |
| SMILES | CO[C@@H]([C@](C(=O)OCC1=CCN2[C@H]1[C@@H](O)CC2)(C(C)C)O)C |
| Inchi | InChI=1S/C16H27NO5/c1-10(2)16(20,11(3)21-4)15(19)22-9-12-5-7-17-8-6-13(18)14(12)17/h5,10-11,13-14,18,20H,6-9H2,1-4H3/t11-,13+,14-,16+/m1/s1 |
| IUPAC | |
| Molecular Weight | 313.19 |
| Pubchem Id | 906426 |
| Chembl Id | CHEMBL2165593 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2165593 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
