Showing entry for 5'-Prenylbutein
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0048885 |
| Compound Name | 5'-Prenylbutein |
| Structure | ![]() |
| Formula | C20H20O5 |
| InchiKey | XHTOWVVXFDSBGH-XBXARRHUSA-N |
| SMILES | CC(=CCc1cc(/C=C/C(=O)c2ccc(cc2O)O)cc(c1O)O)C |
| Inchi | InChI=1S/C20H20O5/c1-12(2)3-5-14-9-13(10-19(24)20(14)25)4-8-17(22)16-7-6-15(21)11-18(16)23/h3-4,6-11,21,23-25H,5H2,1-2H3/b8-4+ |
| IUPAC | (E)-3-[3,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| Molecular Weight | 340.13 |
| Pubchem Id | 11267805 |
| Chembl Id | CHEMBL253677 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL253677 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
