Showing entry for (R)-Ethyl 2-hydroxypropanoate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049080 |
| Compound Name | (R)-Ethyl 2-hydroxypropanoate |
| Structure | ![]() |
| Formula | C5H10O3 |
| InchiKey | LZCLXQDLBQLTDK-SCSAIBSYSA-N |
| SMILES | CCOC(=O)[C@H](O)C |
| Inchi | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| IUPAC | ethyl (2R)-2-hydroxypropanoate |
| Molecular Weight | 118.06 |
| Pubchem Id | 637513 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 9YL |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
