Showing entry for Sarcovagine C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049163 |
| Compound Name | Sarcovagine C |
| Structure | ![]() |
| Formula | C29H48N2O3 |
| InchiKey | JGVUURLOQKRQKQ-ZLTQYVKSSA-N |
| SMILES | CN[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C)CC[C@@H]([C@@H]2OC(=O)C)N=C(/C(=C/C)/C)O)C |
| Inchi | InChI=1S/C29H48N2O3/c1-8-17(2)27(33)31-25-14-16-29(6)23-13-15-28(5)21(18(3)30-7)11-12-22(28)20(23)9-10-24(29)26(25)34-19(4)32/h8,18,20-26,30H,9-16H2,1-7H3,(H,31,33)/b17-8+/t18-,20-,21+,22-,23-,24-,25-,26+,28+,29+/m0/s1 |
| IUPAC | [(3S,4R,5R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(1S)-1-(methylamino)ethyl]-3-[[(E)-2-methylbut-2-enoyl]amino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl] acetate |
| Molecular Weight | 472.37 |
| Pubchem Id | 25033601 |
| Chembl Id | CHEMBL504924 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50272555 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL504924 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
